EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N4O7P2S |
| Net Charge | -2 |
| Average Mass | 422.296 |
| Monoisotopic Mass | 422.02259 |
| SMILES | Cc1ncc(C[n+]2csc(CCOP(=O)([O-])OP(=O)([O-])[O-])c2C)c(N)n1 |
| InChI | InChI=1S/C12H18N4O7P2S/c1-8-11(3-4-22-25(20,21)23-24(17,18)19)26-7-16(8)6-10-5-14-9(2)15-12(10)13/h5,7H,3-4,6H2,1-2H3,(H4-,13,14,15,17,18,19,20,21)/p-2 |
| InChIKey | AYEKOFBPNLCAJY-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiamine(1+) diphosphate(3−) (CHEBI:58937) has role cofactor (CHEBI:23357) |
| thiamine(1+) diphosphate(3−) (CHEBI:58937) is a organophosphate oxoanion (CHEBI:58945) |
| thiamine(1+) diphosphate(3−) (CHEBI:58937) is a vitamin B1 (CHEBI:26948) |
| thiamine(1+) diphosphate(3−) (CHEBI:58937) is conjugate base of thiamine(1+) diphosphate(1−) (CHEBI:45931) |
| Incoming Relation(s) |
| thiamine(1+) diphosphate(1−) (CHEBI:45931) is conjugate acid of thiamine(1+) diphosphate(3−) (CHEBI:58937) |
| IUPAC Name |
|---|
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-5-(2-{[oxido(phosphonatooxy)phosphoryl]oxy}ethyl)-1,3-thiazol-3-ium |
| Synonyms | Source |
|---|---|
| thiamine diphosphate(2−) | ChEBI |
| thiamine diphosphate dianion | ChEBI |
| thiamine pyrophosphate(2−) | ChEBI |
| thiamine pyrophosphate dianion | ChEBI |
| thiamin pyrophosphate | ChEBI |
| thiamin pyrophosphate(2−) | ChEBI |
| UniProt Name | Source |
|---|---|
| thiamine diphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| THIAMINE-PYROPHOSPHATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:907009 | Gmelin |