EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClN3O3S |
| Net Charge | 0 |
| Average Mass | 365.842 |
| Monoisotopic Mass | 365.06009 |
| SMILES | CC1Cc2ccccc2N1NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-10-8-11-4-2-3-5-14(11)20(10)19-16(21)12-6-7-13(17)15(9-12)24(18,22)23/h2-7,9-10H,8H2,1H3,(H,19,21)(H2,18,22,23) |
| InChIKey | NDDAHWYSQHTHNT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indapamide (CHEBI:5893) has functional parent benzamide (CHEBI:28179) |
| indapamide (CHEBI:5893) has role antihypertensive agent (CHEBI:35674) |
| indapamide (CHEBI:5893) has role diuretic (CHEBI:35498) |
| indapamide (CHEBI:5893) is a indoles (CHEBI:24828) |
| indapamide (CHEBI:5893) is a organochlorine compound (CHEBI:36683) |
| indapamide (CHEBI:5893) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-chloro-N-(2-methyl-2,3-dihydro-1H-indol-1-yl)-3-sulfamoylbenzamide |
| INNs | Source |
|---|---|
| indapamida | DrugBank |
| indapamidum | DrugBank |
| Synonym | Source |
|---|---|
| Indapamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1604026 | Reaxys |
| CAS:26807-65-8 | ChemIDplus |
| Citations |
|---|