EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N5O7P |
| Net Charge | -2 |
| Average Mass | 343.192 |
| Monoisotopic Mass | 343.03288 |
| SMILES | Nc1nc2c(c(=O)n1)NC1C(=O)[C-]3OP(=O)([O-])OCC3OC1N2 |
| InChI | InChI=1S/C10H11N5O7P/c11-10-14-7-4(8(17)15-10)12-3-5(16)6-2(21-9(3)13-7)1-20-23(18,19)22-6/h2-3,9,12H,1H2,(H,18,19)(H4,11,13,14,15,17)/q-1/p-1 |
| InChIKey | ROJNDKOWKSXJGJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| precursor Z(2−) (CHEBI:58907) is a dialkyl phosphate anion (CHEBI:58944) |
| precursor Z(2−) (CHEBI:58907) is conjugate base of precursor Z(1−) (CHEBI:59648) |
| Incoming Relation(s) |
| precursor Z(1−) (CHEBI:59648) is conjugate acid of precursor Z(2−) (CHEBI:58907) |
| IUPAC Name |
|---|
| 8-amino-10,12-dioxo-4,4a,6,9,10,11,11a,12-octahydro-5aH-[1,3,2]dioxaphosphinino[4',5':5,6]pyrano[3,2-g]pteridin-12a-id-2-olate 2-oxide |
| Citations |
|---|