EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15O7 |
| Net Charge | -1 |
| Average Mass | 295.267 |
| Monoisotopic Mass | 295.08233 |
| SMILES | O=C([O-])c1cccc(C(=O)CC[C@H]2OC(O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C14H16O7/c15-9(7-2-1-3-8(6-7)13(18)19)4-5-10-11(16)12(17)14(20)21-10/h1-3,6,10-12,14,16-17,20H,4-5H2,(H,18,19)/p-1/t10-,11-,12-,14?/m1/s1 |
| InChIKey | XWPBBHHZDYSYMS-ZXRVKKJVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehypoxanthine futalosinate (CHEBI:58864) is a 5-oxo monocarboxylic acid anion (CHEBI:35975) |
| dehypoxanthine futalosinate (CHEBI:58864) is conjugate base of dehypoxanthine futalosine (CHEBI:51312) |
| Incoming Relation(s) |
| dehypoxanthine futalosine (CHEBI:51312) is conjugate acid of dehypoxanthine futalosinate (CHEBI:58864) |
| IUPAC Name |
|---|
| 3-{3-[(2R,3S,4R)-3,4,5-trihydroxytetrahydrofuran-2-yl]propanoyl}benzoate |
| UniProt Name | Source |
|---|---|
| dehypoxanthine futalosine | UniProt |