EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3NO4 |
| Net Charge | -2 |
| Average Mass | 129.071 |
| Monoisotopic Mass | 129.00730 |
| SMILES | N=C(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C4H5NO4/c5-2(4(8)9)1-3(6)7/h5H,1H2,(H,6,7)(H,8,9)/p-2 |
| InChIKey | NMUOATVLLQEYHI-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iminoaspartate (CHEBI:58831) is a C4-dicarboxylate (CHEBI:61336) |
| iminoaspartate (CHEBI:58831) is a dicarboxylic acid dianion (CHEBI:28965) |
| iminoaspartate (CHEBI:58831) is conjugate base of iminoaspartate(1−) (CHEBI:77875) |
| iminoaspartate (CHEBI:58831) is conjugate base of iminoaspartic acid (CHEBI:50616) |
| Incoming Relation(s) |
| iminoaspartate(1−) (CHEBI:77875) is conjugate acid of iminoaspartate (CHEBI:58831) |
| iminoaspartic acid (CHEBI:50616) is conjugate acid of iminoaspartate (CHEBI:58831) |
| IUPAC Name |
|---|
| 2-iminobutanedioate |
| Synonym | Source |
|---|---|
| 2-iminosuccinate | ChEBI |