EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H41O7S |
| Net Charge | -1 |
| Average Mass | 473.652 |
| Monoisotopic Mass | 473.25785 |
| SMILES | [H][C@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCOS(=O)(=O)[O-])[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C24H42O7S/c1-14(5-4-10-31-32(28,29)30)17-6-7-18-22-19(13-21(27)24(17,18)3)23(2)9-8-16(25)11-15(23)12-20(22)26/h14-22,25-27H,4-13H2,1-3H3,(H,28,29,30)/p-1/t14-,15-,16-,17-,18+,19+,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | BKZKSSHAWFCVDU-JLIFGLSWSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate(1−) (CHEBI:58809) is a steroid sulfate oxoanion (CHEBI:59696) |
| 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate(1−) (CHEBI:58809) is conjugate base of 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate (CHEBI:50109) |
| Incoming Relation(s) |
| 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate (CHEBI:50109) is conjugate acid of 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate(1−) (CHEBI:58809) |
| IUPAC Name |
|---|
| 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate |
| Synonym | Source |
|---|---|
| 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3α,7α,12α-trihydroxy-5α-cholan-24-yl sulfate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11197773 | Beilstein |