EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O4 |
| Net Charge | -1 |
| Average Mass | 143.118 |
| Monoisotopic Mass | 143.03498 |
| SMILES | O=C1C[C@@H](CO)OC=C1[O-] |
| InChI | InChI=1S/C6H8O4/c7-2-4-1-5(8)6(9)3-10-4/h3-4,7,9H,1-2H2/p-1/t4-/m0/s1 |
| InChIKey | ZXCYXCIWKAILMP-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascopyrone P(1−) (CHEBI:58807) is a organic anion (CHEBI:25696) |
| ascopyrone P(1−) (CHEBI:58807) is conjugate base of ascopyrone P (CHEBI:50071) |
| Incoming Relation(s) |
| ascopyrone P (CHEBI:50071) is conjugate acid of ascopyrone P(1−) (CHEBI:58807) |
| IUPAC Name |
|---|
| (2S)-2-(hydroxymethyl)-4-oxo-3,4-dihydro-2H-pyran-5-olate |