EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | [NH3+]CCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H9NO3/c6-3-1-2-4(7)5(8)9/h1-3,6H2,(H,8,9) |
| InChIKey | BWHGMFYTDQEALD-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-amino-2-oxopentanoic acid zwitterion (CHEBI:58802) is a amino-acid zwitterion (CHEBI:35238) |
| 5-amino-2-oxopentanoic acid zwitterion (CHEBI:58802) is tautomer of 5-amino-2-oxopentanoic acid (CHEBI:49268) |
| Incoming Relation(s) |
| 5-amino-2-oxopentanoic acid (CHEBI:49268) is tautomer of 5-amino-2-oxopentanoic acid zwitterion (CHEBI:58802) |
| IUPAC Name |
|---|
| 5-azaniumyl-2-oxopentanoate |
| Synonym | Source |
|---|---|
| 5-ammonio-2-oxopentanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-amino-2-oxopentanoate | UniProt |