EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4NO4 |
| Net Charge | -1 |
| Average Mass | 154.101 |
| Monoisotopic Mass | 154.01458 |
| SMILES | O=C([O-])c1ccc(O)nc1O |
| InChI | InChI=1S/C6H5NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h1-2H,(H,10,11)(H2,7,8,9)/p-1 |
| InChIKey | IGCZQNUHGOYVJI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dihydroxynicotinate (CHEBI:58780) is a monocarboxylic acid anion (CHEBI:35757) |
| 2,6-dihydroxynicotinate (CHEBI:58780) is conjugate base of 2,6-dihydroxynicotinic acid (CHEBI:49087) |
| Incoming Relation(s) |
| 2,6-dihydroxynicotinic acid (CHEBI:49087) is conjugate acid of 2,6-dihydroxynicotinate (CHEBI:58780) |
| IUPAC Name |
|---|
| 2,6-dihydroxypyridine-3-carboxylate |
| UniProt Name | Source |
|---|---|
| 2,6-dihydroxynicotinate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4425915 | Beilstein |