EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25N4O11P2 |
| Net Charge | -1 |
| Average Mass | 487.319 |
| Monoisotopic Mass | 487.10005 |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H26N4O11P2/c1-18(2,3)6-7-26-30(22,23)29-31(24,25)27-8-9-11(19)12(20)13(28-9)17-5-4-10(15)16-14(17)21/h4-5,9,11-13,19-20H,6-8H2,1-3H3,(H3-,15,16,21,22,23,24,25)/p-1/t9-,11-,12-,13-/m1/s1 |
| InChIKey | RZZPDXZPRHQOCG-OJAKKHQRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-choline(1−) (CHEBI:58779) is a organophosphate oxoanion (CHEBI:58945) |
| CDP-choline(1−) (CHEBI:58779) is conjugate base of CDP-choline(1+) (CHEBI:49086) |
| Incoming Relation(s) |
| CDP-choline(1+) (CHEBI:49086) is conjugate acid of CDP-choline(1−) (CHEBI:58779) |
| IUPAC Name |
|---|
| 5'-O-[({[2-(trimethylazaniumyl)ethoxy]phosphinato}oxy)phosphinato]cytidine |
| UniProt Name | Source |
|---|---|
| CDP-choline | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4170622 | Beilstein |