EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO3S |
| Net Charge | 0 |
| Average Mass | 165.214 |
| Monoisotopic Mass | 165.04596 |
| SMILES | C[S@@](=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-,10+/m0/s1 |
| InChIKey | QEFRNWWLZKMPFJ-ZXPFJRLXSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methionine (R)-S-oxide zwitterion (CHEBI:58773) is a amino-acid zwitterion (CHEBI:35238) |
| L-methionine (R)-S-oxide zwitterion (CHEBI:58773) is tautomer of L-methionine (R)-S-oxide (CHEBI:49032) |
| Incoming Relation(s) |
| L-methionine (R)-S-oxide (CHEBI:49032) is tautomer of L-methionine (R)-S-oxide zwitterion (CHEBI:58773) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-[(R)-methylsulfinyl]butanoate |
| UniProt Name | Source |
|---|---|
| L-methionine (R)-S-oxide | UniProt |