EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N10O15P2 |
| Net Charge | -3 |
| Average Mass | 705.407 |
| Monoisotopic Mass | 705.08360 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])O[C@H]4[C@@H](O)[C@H](n5cnc6c(=O)nc(N)nc65)O[C@@H]4COP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H26N10O15P2/c21-19-25-13-7(15(34)27-19)23-3-29(13)17-10(32)9(31)5(43-17)1-42-47(39,40)45-12-6(2-41-46(36,37)38)44-18(11(12)33)30-4-24-8-14(30)26-20(22)28-16(8)35/h3-6,9-12,17-18,31-33H,1-2H2,(H,39,40)(H2,36,37,38)(H3,21,25,27,34)(H3,22,26,28,35)/p-3/t5-,6-,9-,10-,11-,12-,17-,18-/m1/s1 |
| InChIKey | ZEHOHLFQOXAZHX-MHARETSRSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pGpG(3−) (CHEBI:58754) is a organophosphate oxoanion (CHEBI:58945) |
| pGpG(3−) (CHEBI:58754) is conjugate base of pGpG (CHEBI:48622) |
| Incoming Relation(s) |
| pGpG (CHEBI:48622) is conjugate acid of pGpG(3−) (CHEBI:58754) |
| UniProt Name | Source |
|---|---|
| 5'-phosphoguanylyl(3'→5')guanosine | UniProt |