EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H45O4 |
| Net Charge | -1 |
| Average Mass | 433.653 |
| Monoisotopic Mass | 433.33233 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC[C@@H](C)C(=O)[O-])[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O4/c1-16(6-5-7-17(2)25(30)31)20-8-9-21-24-22(11-13-27(20,21)4)26(3)12-10-19(28)14-18(26)15-23(24)29/h16-24,28-29H,5-15H2,1-4H3,(H,30,31)/p-1/t16-,17-,18+,19-,20-,21+,22+,23-,24+,26+,27-/m1/s1 |
| InChIKey | ITZYGDKGRKKBSN-RXDNHGQQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oate (CHEBI:58750) is a bile acid anion (CHEBI:36235) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oate (CHEBI:58750) is conjugate base of (25R)-3α,7α-dihydroxy-5β-cholestan-26-oic acid (CHEBI:48467) |
| Incoming Relation(s) |
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oic acid (CHEBI:48467) is conjugate acid of (25R)-3α,7α-dihydroxy-5β-cholestan-26-oate (CHEBI:58750) |
| IUPAC Name |
|---|
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oate |
| UniProt Name | Source |
|---|---|
| (25R)-3α,7α-dihydroxy-5β-cholestan-26-oate | UniProt |