EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O21P5 |
| Net Charge | -10 |
| Average Mass | 569.971 |
| Monoisotopic Mass | 569.82228 |
| SMILES | O=P([O-])([O-])O[C@@H]1[C@H](OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@@H](O)[C@H](OP(=O)([O-])[O-])[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H17O21P5/c7-1-2(23-28(8,9)10)4(25-30(14,15)16)6(27-32(20,21)22)5(26-31(17,18)19)3(1)24-29(11,12)13/h1-7H,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/p-10/t1-,2-,3+,4-,5-,6-/m1/s1 |
| InChIKey | CTPQAXVNYGZUAJ-UOTPTPDRSA-D |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 1,2,3,5,6-pentakisphosphate(10−) (CHEBI:58747) is a inositol phosphate oxoanion (CHEBI:76301) |
| 1D-myo-inositol 1,2,3,5,6-pentakisphosphate(10−) (CHEBI:58747) is conjugate base of 1D-myo-inositol 1,2,3,5,6-pentakisphosphate (CHEBI:48405) |
| Incoming Relation(s) |
| 1D-myo-inositol 1,2,3,5,6-pentakisphosphate (CHEBI:48405) is conjugate acid of 1D-myo-inositol 1,2,3,5,6-pentakisphosphate(10−) (CHEBI:58747) |
| IUPAC Name |
|---|
| 1D-myo-inositol 1,2,3,5,6-pentakis(phosphate) |
| Synonym | Source |
|---|---|
| (1R,2R,3S,4R,5S,6S)-6-hydroxycyclohexane-1,2,3,4,5-pentayl pentakis(phosphate) | ChEBI |
| UniProt Name | Source |
|---|---|
| 1D-myo-inositol 1,2,3,5,6-pentakisphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8035380 | Beilstein |