EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6NO2 |
| Net Charge | -1 |
| Average Mass | 100.097 |
| Monoisotopic Mass | 100.04040 |
| SMILES | [H]C(C)=C(N)C(=O)[O-] |
| InChI | InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2H,5H2,1H3,(H,6,7)/p-1 |
| InChIKey | PAWSVPVNIXFKOS-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminobut-2-enoate (CHEBI:58739) is a α-amino-acid anion (CHEBI:33558) |
| 2-aminobut-2-enoate (CHEBI:58739) is conjugate base of 2-aminobut-2-enoic acid (CHEBI:48305) |
| 2-aminobut-2-enoate (CHEBI:58739) is conjugate base of 2-aminobut-2-enoic acid zwitterion (CHEBI:48306) |
| Incoming Relation(s) |
| 2-aminobut-2-enoic acid (CHEBI:48305) is conjugate acid of 2-aminobut-2-enoate (CHEBI:58739) |
| 2-aminobut-2-enoic acid zwitterion (CHEBI:48306) is conjugate acid of 2-aminobut-2-enoate (CHEBI:58739) |
| IUPAC Name |
|---|
| 2-aminobut-2-enoate |