EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N2O4 |
| Net Charge | -1 |
| Average Mass | 235.219 |
| Monoisotopic Mass | 235.07243 |
| SMILES | O=C([O-])[C@H](Cc1cnc2ccccc12)N(O)O |
| InChI | InChI=1S/C11H12N2O4/c14-11(15)10(13(16)17)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12,16-17H,5H2,(H,14,15)/p-1/t10-/m0/s1 |
| InChIKey | FKJQZUQEYSGYFZ-JTQLQIEISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dihydroxy-L-tryptophanate (CHEBI:58729) is a N,N-dihydroxy-α-amino-acid anion (CHEBI:59699) |
| N,N-dihydroxy-L-tryptophanate (CHEBI:58729) is conjugate base of N,N-dihydroxy-L-tryptophan (CHEBI:47993) |
| Incoming Relation(s) |
| N,N-dihydroxy-L-tryptophan (CHEBI:47993) is conjugate acid of N,N-dihydroxy-L-tryptophanate (CHEBI:58729) |
| IUPAC Name |
|---|
| N,N-dihydroxy-L-tryptophanate |
| UniProt Name | Source |
|---|---|
| N,N-dihydroxy-L-tryptophan | UniProt |