EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO3 |
| Net Charge | -1 |
| Average Mass | 180.183 |
| Monoisotopic Mass | 180.06662 |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)NO |
| InChI | InChI=1S/C9H11NO3/c11-9(12)8(10-13)6-7-4-2-1-3-5-7/h1-5,8,10,13H,6H2,(H,11,12)/p-1/t8-/m0/s1 |
| InChIKey | VTPJSQTVPKSYCB-QMMMGPOBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-L-phenylalaninate (CHEBI:58726) is a N-hydroxy-α-amino-acid anion (CHEBI:59258) |
| N-hydroxy-L-phenylalaninate (CHEBI:58726) is conjugate base of N-hydroxy-L-phenylalanine (CHEBI:47990) |
| Incoming Relation(s) |
| N-hydroxy-L-phenylalanine (CHEBI:47990) is conjugate acid of N-hydroxy-L-phenylalaninate (CHEBI:58726) |
| IUPAC Name |
|---|
| N-hydroxy-L-phenylalaninate |
| UniProt Name | Source |
|---|---|
| N-hydroxy-L-phenylalanine | UniProt |