EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33O4 |
| Net Charge | -1 |
| Average Mass | 373.513 |
| Monoisotopic Mass | 373.23843 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CC(=O)[O-])[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C23H34O4/c1-14(11-22(26)27)19-8-9-20-16(5-4-10-23(19,20)3)6-7-17-12-18(24)13-21(25)15(17)2/h6-7,14,18-21,24-25H,2,4-5,8-13H2,1,3H3,(H,26,27)/p-1/b16-6+,17-7-/t14-,18-,19-,20+,21+,23-/m1/s1 |
| InChIKey | MBLYZRMZFUWLOZ-ZTIKAOTBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calcitroate (CHEBI:58715) is a monocarboxylic acid anion (CHEBI:35757) |
| calcitroate (CHEBI:58715) is conjugate base of calcitroic acid (CHEBI:47828) |
| Incoming Relation(s) |
| calcitroic acid (CHEBI:47828) is conjugate acid of calcitroate (CHEBI:58715) |
| IUPAC Name |
|---|
| (1S,3R,5Z,7E)-1,3-dihydroxy-24-nor-9,10-secochola-5,7,10(19)-trien-23-oate |
| UniProt Name | Source |
|---|---|
| calcitroate | UniProt |