EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 238.674 |
| Monoisotopic Mass | 238.05091 |
| SMILES | [NH3+][C@@H](Cc1cnc2c(Cl)cccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H11ClN2O2/c12-8-3-1-2-7-6(5-14-10(7)8)4-9(13)11(15)16/h1-3,5,9,14H,4,13H2,(H,15,16)/t9-/m0/s1 |
| InChIKey | DMQFGLHRDFQKNR-VIFPVBQESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-chloro-L-tryptophan zwitterion (CHEBI:58713) is a amino-acid zwitterion (CHEBI:35238) |
| 7-chloro-L-tryptophan zwitterion (CHEBI:58713) is tautomer of 7-chloro-L-tryptophan (CHEBI:47356) |
| Incoming Relation(s) |
| 7-chloro-L-tryptophan (CHEBI:47356) is tautomer of 7-chloro-L-tryptophan zwitterion (CHEBI:58713) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(7-chloro-1H-indol-3-yl)propanoate |
| UniProt Name | Source |
|---|---|
| 7-chloro-L-tryptophan | UniProt |