EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O5 |
| Net Charge | -1 |
| Average Mass | 159.117 |
| Monoisotopic Mass | 159.02990 |
| SMILES | O=C1C([O-])=C[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H8O5/c7-2-1-3(8)5(10)6(11)4(2)9/h1-2,4,6-9,11H/p-1/t2-,4+,6-/m1/s1 |
| InChIKey | YHPMNQOQULEBNK-CJPQEGFPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4S,5R)-3,4,5-trihydroxy-6-oxocyclohex-1-en-1-olate (CHEBI:58691) is a organic anion (CHEBI:25696) |
| (3R,4S,5R)-3,4,5-trihydroxy-6-oxocyclohex-1-en-1-olate (CHEBI:58691) is conjugate base of (4R,5S,6R)-2,4,5,6-tetrahydroxycyclohex-2-en-1-one (CHEBI:4077) |
| Incoming Relation(s) |
| (4R,5S,6R)-2,4,5,6-tetrahydroxycyclohex-2-en-1-one (CHEBI:4077) is conjugate acid of (3R,4S,5R)-3,4,5-trihydroxy-6-oxocyclohex-1-en-1-olate (CHEBI:58691) |
| IUPAC Name |
|---|
| (3R,4S,5R)-3,4,5-trihydroxy-6-oxocyclohex-1-en-1-olate |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5013309 | Beilstein |