EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H31MgN4O5 |
| Net Charge | -1 |
| Average Mass | 611.961 |
| Monoisotopic Mass | 611.21504 |
| SMILES | C=CC1=C(C)C2=[N+]3C1=Cc1c(C)c4c5[n]1[Mg-2]31[n]3c(c(C)c(C=C)c3=C2)=CC2=[N+]1C(=C5[C@@H](C(=O)OC)C4=O)[C@@H](CCC(=O)[O-])[C@@H]2C |
| InChI | InChI=1S/C35H34N4O5.Mg/c1-8-19-15(3)22-12-24-17(5)21(10-11-28(40)41)32(38-24)30-31(35(43)44-7)34(42)29-18(6)25(39-33(29)30)14-27-20(9-2)16(4)23(37-27)13-26(19)36-22;/h8-9,12-14,17,21,31H,1-2,10-11H2,3-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-3/t17-,21-,31+;/m0./s1 |
| InChIKey | IQLDSMIBDORHSF-NYABAGMLSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| divinyl chlorophyllide a(1−) (CHEBI:58688) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| divinyl chlorophyllide a(1−) (CHEBI:58688) is conjugate acid of divinyl chlorophyllide a(2−) (CHEBI:83349) |
| divinyl chlorophyllide a(1−) (CHEBI:58688) is conjugate base of divinyl chlorophyllide a (CHEBI:38259) |
| Incoming Relation(s) |
| divinyl chlorophyllide a (CHEBI:38259) is conjugate acid of divinyl chlorophyllide a(1−) (CHEBI:58688) |
| divinyl chlorophyllide a(2−) (CHEBI:83349) is conjugate base of divinyl chlorophyllide a(1−) (CHEBI:58688) |