EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N2O2 |
| Net Charge | +1 |
| Average Mass | 195.242 |
| Monoisotopic Mass | 195.11280 |
| SMILES | C[NH2+]CCCC(=O)c1ccc(O)nc1 |
| InChI | InChI=1S/C10H14N2O2/c1-11-6-2-3-9(13)8-4-5-10(14)12-7-8/h4-5,7,11H,2-3,6H2,1H3,(H,12,14)/p+1 |
| InChIKey | UMLOUOBDBGOHHR-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) is a ammonium ion derivative (CHEBI:35274) |
| 6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) is conjugate acid of 6-hydroxypseudooxynicotine (CHEBI:37754) |
| Incoming Relation(s) |
| 6-hydroxypseudooxynicotine (CHEBI:37754) is conjugate base of 6-hydroxypseudooxynicotinium(1+) (CHEBI:58682) |
| IUPAC Name |
|---|
| 4-(6-hydroxypyridin-3-yl)-N-methyl-4-oxobutan-1-aminium |
| UniProt Name | Source |
|---|---|
| 6-hydroxypseudooxynicotine | UniProt |