EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14Cl2N2O.HNO3 |
| Net Charge | 0 |
| Average Mass | 360.197 |
| Monoisotopic Mass | 359.04396 |
| SMILES | C=CCOC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C14H14Cl2N2O.HNO3/c1-2-7-19-14(9-18-6-5-17-10-18)12-4-3-11(15)8-13(12)16;2-1(3)4/h2-6,8,10,14H,1,7,9H2;(H,2,3,4) |
| InChIKey | KJTYJTCKKSDSQF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Imazalil nitrate (CHEBI:5868) is a conazole fungicide (CHEBI:87067) |
| Imazalil nitrate (CHEBI:5868) is a imidazole fungicide (CHEBI:87068) |
| Synonym | Source |
|---|---|
| Imazalil nitrate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11219 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:33586-66-2 | KEGG COMPOUND |