EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H8N3O5PS |
| Net Charge | -2 |
| Average Mass | 229.154 |
| Monoisotopic Mass | 228.99333 |
| SMILES | [NH2+]=C(NCCS(=O)[O-])NP(=O)([O-])[O-] |
| InChI | InChI=1S/C3H10N3O5PS/c4-3(6-12(7,8)9)5-1-2-13(10)11/h1-2H2,(H,10,11)(H5,4,5,6,7,8,9)/p-2 |
| InChIKey | ZGZSALVJNJADDS-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-phosphohypotaurocyamine(2−) (CHEBI:58652) is a alkanesulfinate (CHEBI:22319) |
| Nω-phosphohypotaurocyamine(2−) (CHEBI:58652) is conjugate base of Nω-phosphohypotaurocyamine (CHEBI:32989) |
| Incoming Relation(s) |
| Nω-phosphohypotaurocyamine (CHEBI:32989) is conjugate acid of Nω-phosphohypotaurocyamine(2−) (CHEBI:58652) |
| IUPAC Name |
|---|
| 2-{[iminio(phosphonatoamino)methyl]amino}ethanesulfinate |
| UniProt Name | Source |
|---|---|
| Nω-phosphohypotaurocyamine | UniProt |