EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N4O2 |
| Net Charge | +1 |
| Average Mass | 277.348 |
| Monoisotopic Mass | 277.16590 |
| SMILES | [H]C(=CC(=O)NCCCCNC(N)=[NH2+])c1ccc(O)cc1 |
| InChI | InChI=1S/C14H20N4O2/c15-14(16)18-10-2-1-9-17-13(20)8-5-11-3-6-12(19)7-4-11/h3-8,19H,1-2,9-10H2,(H,17,20)(H4,15,16,18)/p+1 |
| InChIKey | AKIHYQWCLCDMMI-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-coumaroylagmatine(1+) (CHEBI:58644) is a guanidinium ion (CHEBI:60251) |
| p-coumaroylagmatine(1+) (CHEBI:58644) is conjugate acid of p-coumaroylagmatine (CHEBI:32818) |
| Incoming Relation(s) |
| (E)-p-coumaroylagmatine(1+) (CHEBI:86078) is a p-coumaroylagmatine(1+) (CHEBI:58644) |
| (Z)-p-coumaroylagmatine(1+) (CHEBI:86083) is a p-coumaroylagmatine(1+) (CHEBI:58644) |
| p-coumaroylagmatine (CHEBI:32818) is conjugate base of p-coumaroylagmatine(1+) (CHEBI:58644) |
| IUPAC Name |
|---|
| amino[(4-{[3-(4-hydroxyphenyl)acryloyl]amino}butyl)amino]methaniminium |
| UniProt Name | Source |
|---|---|
| N-(4-guanidinobutyl)-4-hydroxycinnamamide | UniProt |