EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O7P2 |
| Net Charge | -3 |
| Average Mass | 447.425 |
| Monoisotopic Mass | 447.17180 |
| SMILES | [H][C@@]12CCC(=C)[C@@H](CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-])[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H36O7P2/c1-15(11-14-26-29(24,25)27-28(21,22)23)7-9-17-16(2)8-10-18-19(3,4)12-6-13-20(17,18)5/h11,17-18H,2,6-10,12-14H2,1,3-5H3,(H,24,25)(H2,21,22,23)/p-3/b15-11+/t17-,18+,20-/m1/s1 |
| InChIKey | JCAIWDXKLCEQEO-HZEYQZKKSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α,9β,10α-labda-8(20),13-dien-15-yl diphosphate(3−) (CHEBI:58622) is a organophosphate oxoanion (CHEBI:58945) |
| 5α,9β,10α-labda-8(20),13-dien-15-yl diphosphate(3−) (CHEBI:58622) is conjugate base of 5α,9β,10α-labda-8(20),13-dien-15-yl diphosphate (CHEBI:29739) |
| Incoming Relation(s) |
| 5α,9β,10α-labda-8(20),13-dien-15-yl diphosphate (CHEBI:29739) is conjugate acid of 5α,9β,10α-labda-8(20),13-dien-15-yl diphosphate(3−) (CHEBI:58622) |
| IUPAC Names |
|---|
| 3-methyl-5-[(1R,4aS,8aS)-5,5,8a-trimethyl-2-methylenedecahydronaphthalen-1-yl]pent-2-en-1-yl diphosphate |
| 5α,9β,10α-labda-8(20),13-dien-15-yl diphosphate |
| UniProt Name | Source |
|---|---|
| 9α-copalyl diphosphate | UniProt |