EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19Cl2NO4 |
| Net Charge | 0 |
| Average Mass | 384.259 |
| Monoisotopic Mass | 383.06911 |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
| InChIKey | RZTAMFZIAATZDJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felodipine (CHEBI:585948) has role anti-arrhythmia drug (CHEBI:38070) |
| felodipine (CHEBI:585948) has role antihypertensive agent (CHEBI:35674) |
| felodipine (CHEBI:585948) has role calcium channel blocker (CHEBI:38215) |
| felodipine (CHEBI:585948) has role vasodilator agent (CHEBI:35620) |
| felodipine (CHEBI:585948) is a dichlorobenzene (CHEBI:23697) |
| felodipine (CHEBI:585948) is a dihydropyridine (CHEBI:50075) |
| felodipine (CHEBI:585948) is a ethyl ester (CHEBI:23990) |
| felodipine (CHEBI:585948) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| felodipina | ChemIDplus |
| felodipine | ChemIDplus |
| felodipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate | NIST Chemistry WebBook |
| 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester | ChEBI |
| (±)-ethyl methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate | ChemIDplus |
| FELODIPINE | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4331472 | Reaxys |
| CAS:72509-76-3 | KEGG DRUG |
| CAS:72509-76-3 | NIST Chemistry WebBook |
| CAS:72509-76-3 | ChemIDplus |
| Citations |
|---|