EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19Cl2NO4 |
| Net Charge | 0 |
| Average Mass | 384.259 |
| Monoisotopic Mass | 383.06911 |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
| InChIKey | RZTAMFZIAATZDJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felodipine (CHEBI:585948) has role anti-arrhythmia drug (CHEBI:38070) |
| felodipine (CHEBI:585948) has role antiatherosclerotic agent (CHEBI:145947) |
| felodipine (CHEBI:585948) has role antihypertensive agent (CHEBI:35674) |
| felodipine (CHEBI:585948) has role calcium channel blocker (CHEBI:38215) |
| felodipine (CHEBI:585948) has role cardiovascular drug (CHEBI:35554) |
| felodipine (CHEBI:585948) has role hypoglycemic agent (CHEBI:35526) |
| felodipine (CHEBI:585948) has role vasodilator agent (CHEBI:35620) |
| felodipine (CHEBI:585948) is a dichlorobenzene (CHEBI:23697) |
| felodipine (CHEBI:585948) is a dihydropyridine (CHEBI:50075) |
| felodipine (CHEBI:585948) is a ethyl ester (CHEBI:23990) |
| felodipine (CHEBI:585948) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| felodipina | ChemIDplus |
| felodipine | ChemIDplus |
| felodipino | WHO MedNet |
| felodipinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate | NIST Chemistry WebBook |
| 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester | ChEBI |
| C08CA02 | ChEMBL |
| (±)-ethyl methyl 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate | ChemIDplus |
| FELODIPINE | PDBeChem |
| H 154/82 | ChEMBL |
| Brand Names | Source |
|---|---|
| Cabren | ChEMBL |
| Cardioplen xl | ChEMBL |
| Felodipine component of lexxel | ChEMBL |
| Felogen xl | ChEMBL |
| Felotens xl | ChEMBL |
| Folpik xl | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4331472 | Reaxys |
| CAS:72509-76-3 | ChemIDplus |
| CAS:72509-76-3 | NIST Chemistry WebBook |
| CAS:72509-76-3 | KEGG DRUG |
| Citations |
|---|