EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N3O10P2 |
| Net Charge | -3 |
| Average Mass | 384.154 |
| Monoisotopic Mass | 384.00144 |
| SMILES | [H][C@]1(COP(=O)([O-])OP(=O)([O-])[O-])O[C@@]([H])(n2ccc(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C9H15N3O10P2/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17)/p-3/t5-,6+,8+/m0/s1 |
| InChIKey | FTDHDKPUHBLBTL-SHYZEUOFSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dCDP(3−) (CHEBI:58593) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dCDP(3−) (CHEBI:58593) has role human metabolite (CHEBI:77746) |
| dCDP(3−) (CHEBI:58593) is a 2'-deoxyribonucleoside 5'-diphosphate(3−) (CHEBI:73316) |
| dCDP(3−) (CHEBI:58593) is conjugate base of dCDP (CHEBI:28846) |
| Incoming Relation(s) |
| 2'-deoxy-5-(hydroxymethyl)cytidine 5'-diphosphate(3−) (CHEBI:145464) has functional parent dCDP(3−) (CHEBI:58593) |
| dCDP (CHEBI:28846) is conjugate acid of dCDP(3−) (CHEBI:58593) |
| IUPAC Name |
|---|
| 2'-deoxycytosine 5'-diphosphate |
| UniProt Name | Source |
|---|---|
| dCDP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11523255 | Beilstein |