EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N2O3 |
| Net Charge | -1 |
| Average Mass | 141.106 |
| Monoisotopic Mass | 141.03057 |
| SMILES | C[c-]1c(=O)nc(=O)nc1=O |
| InChI | InChI=1S/C5H5N2O3/c1-2-3(8)6-5(10)7-4(2)9/h1H3,(H2,6,7,8,9,10)/q-1 |
| InChIKey | UBBZMONZPQRPMD-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methylbarbituride (CHEBI:58571) is a organic anion (CHEBI:25696) |
| 5-methylbarbituride (CHEBI:58571) is conjugate base of 5-methylbarbituric acid (CHEBI:28492) |
| Incoming Relation(s) |
| 5-methylbarbituric acid (CHEBI:28492) is conjugate acid of 5-methylbarbituride (CHEBI:58571) |
| IUPAC Name |
|---|
| 5-methyl-2,4,6-trioxohexahydropyrimidin-5-ide |
| UniProt Name | Source |
|---|---|
| 5-methylbarbiturate | UniProt |