EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36N2O3S |
| Net Charge | 0 |
| Average Mass | 384.586 |
| Monoisotopic Mass | 384.24466 |
| SMILES | CCCCCCCN(CC)CCCC(O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H36N2O3S/c1-4-6-7-8-9-16-22(5-2)17-10-11-20(23)18-12-14-19(15-13-18)21-26(3,24)25/h12-15,20-21,23H,4-11,16-17H2,1-3H3 |
| InChIKey | ALOBUEHUHMBRLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ibutilide (CHEBI:5856) has role anti-arrhythmia drug (CHEBI:38070) |
| Ibutilide (CHEBI:5856) is a benzenes (CHEBI:22712) |
| Ibutilide (CHEBI:5856) is a organic amino compound (CHEBI:50047) |
| INN | Source |
|---|---|
| ibutilida | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ibutilide | KEGG COMPOUND |
| ibutilide fumarate | DrugCentral |
| U 82209E | DrugCentral |
| U-82209E | DrugCentral |
| U82209E | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1412 | DrugCentral |
| C07753 | KEGG COMPOUND |
| D08060 | KEGG DRUG |
| HMDB0014453 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:122647-31-8 | KEGG COMPOUND |
| Citations |
|---|