EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:58548 - S-methyl-5-thio-D-ribulose 1-phosphate(2−)
| Formula | C6H11O7PS |
| Net Charge | -2 |
| Average Mass | 258.188 |
| Monoisotopic Mass | 257.99741 |
| SMILES | CSC[C@@H](O)[C@@H](O)C(=O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H13O7PS/c1-15-3-5(8)6(9)4(7)2-13-14(10,11)12/h5-6,8-9H,2-3H2,1H3,(H2,10,11,12)/p-2/t5-,6+/m1/s1 |
| InChIKey | CNSJRYUMVMWNMC-RITPCOANSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-methyl-5-thio-D-ribulose 1-phosphate(2−) (CHEBI:58548) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| S-methyl-5-thio-D-ribulose 1-phosphate(2−) (CHEBI:58548) has role human metabolite (CHEBI:77746) |
| S-methyl-5-thio-D-ribulose 1-phosphate(2−) (CHEBI:58548) is a organophosphate oxoanion (CHEBI:58945) |
| S-methyl-5-thio-D-ribulose 1-phosphate(2−) (CHEBI:58548) is conjugate base of S-methyl-5-thio-D-ribulose 1-phosphate (CHEBI:28096) |
| Incoming Relation(s) |
| S-methyl-5-thio-D-ribulose 1-phosphate (CHEBI:28096) is conjugate acid of S-methyl-5-thio-D-ribulose 1-phosphate(2−) (CHEBI:58548) |
| IUPAC Name |
|---|
| 5-S-methyl-1-O-phosphonato-5-thio-D-ribulose |
| UniProt Name | Source |
|---|---|
| 5-(methylsulfanyl)-D-ribulose 1-phosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11409869 | Beilstein |