EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N3O10P2 |
| Net Charge | -3 |
| Average Mass | 398.181 |
| Monoisotopic Mass | 398.01709 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])[O-])O2)c(=O)nc1N |
| InChI | InChI=1S/C10H17N3O10P2/c1-5-3-13(10(15)12-9(5)11)8-2-6(14)7(22-8)4-21-25(19,20)23-24(16,17)18/h3,6-8,14H,2,4H2,1H3,(H,19,20)(H2,11,12,15)(H2,16,17,18)/p-3/t6-,7+,8+/m0/s1 |
| InChIKey | SHFOWZBOBJJZAP-XLPZGREQSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyldeoxycytidine 5'-diphosphate(3−) (CHEBI:58541) is a organophosphate oxoanion (CHEBI:58945) |
| 5-methyldeoxycytidine 5'-diphosphate(3−) (CHEBI:58541) is conjugate base of 5-methyldeoxycytidine 5'-(trihydrogen diphosphate) (CHEBI:27964) |
| Incoming Relation(s) |
| 5-methyldeoxycytidine 5'-(trihydrogen diphosphate) (CHEBI:27964) is conjugate acid of 5-methyldeoxycytidine 5'-diphosphate(3−) (CHEBI:58541) |
| IUPAC Name |
|---|
| 2'-deoxy-5-methyl-5'-O-[(phosphonatooxy)phosphinato]cytidine |
| UniProt Name | Source |
|---|---|
| 5-methyldeoxycytidine diphosphate | UniProt |