EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5854 - Ibotenic acid
| Formula | C5H6N2O4 |
| Net Charge | 0 |
| Average Mass | 158.113 |
| Monoisotopic Mass | 158.03276 |
| SMILES | NC(C(=O)O)c1cc(O)no1 |
| InChI | InChI=1S/C5H6N2O4/c6-4(5(9)10)2-1-3(8)7-11-2/h1,4H,6H2,(H,7,8)(H,9,10) |
| InChIKey | IRJCBFDCFXCWGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | neurotoxin A poison that interferes with the functions of the nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ibotenic acid (CHEBI:5854) has role neurotoxin (CHEBI:50910) |
| Ibotenic acid (CHEBI:5854) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Ibotenic acid | KEGG COMPOUND |