EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO2Se |
| Net Charge | 0 |
| Average Mass | 182.081 |
| Monoisotopic Mass | 182.97985 |
| SMILES | C[Se]C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2Se/c1-8-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | XDSSPSLGNGIIHP-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methyl-L-selenocysteine zwitterion (CHEBI:58531) is a amino-acid zwitterion (CHEBI:35238) |
| Se-methyl-L-selenocysteine zwitterion (CHEBI:58531) is tautomer of Se-methyl-L-selenocysteine (CHEBI:27812) |
| Incoming Relation(s) |
| Se-methyl-L-selenocysteine (CHEBI:27812) is tautomer of Se-methyl-L-selenocysteine zwitterion (CHEBI:58531) |
| IUPAC Name |
|---|
| (2R)-2-ammonio-3-(methylselanyl)propanoate |
| UniProt Name | Source |
|---|---|
| Se-methyl-L-selenocysteine | UniProt |