EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | C[C@H]([NH3+])CC(=O)CC(=O)[O-] |
| InChI | InChI=1S/C6H11NO3/c1-4(7)2-5(8)3-6(9)10/h4H,2-3,7H2,1H3,(H,9,10)/t4-/m0/s1 |
| InChIKey | FAASBXNEOGMQHS-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5S)-5-amino-3-oxohexanoic acid zwitterion (CHEBI:58523) is a amino-acid zwitterion (CHEBI:35238) |
| (5S)-5-amino-3-oxohexanoic acid zwitterion (CHEBI:58523) is tautomer of (5S)-5-amino-3-oxohexanoic acid (CHEBI:27713) |
| Incoming Relation(s) |
| (5S)-5-amino-3-oxohexanoic acid (CHEBI:27713) is tautomer of (5S)-5-amino-3-oxohexanoic acid zwitterion (CHEBI:58523) |
| IUPAC Name |
|---|
| (5S)-5-ammonio-3-oxohexanoate |
| UniProt Name | Source |
|---|---|
| (5S)-5-amino-3-oxohexanoate | UniProt |