EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | -2 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02262 |
| SMILES | C[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O5/c1-2(4(7)8)3(6)5(9)10/h2-3,6H,1H3,(H,7,8)(H,9,10)/p-2/t2-,3+/m0/s1 |
| InChIKey | NPYQJIHHTGFBLN-STHAYSLISA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-erythro-3-methylmalate(2−) (CHEBI:58511) is a dicarboxylic acid dianion (CHEBI:28965) |
| D-erythro-3-methylmalate(2−) (CHEBI:58511) is conjugate base of D-erythro-3-methylmalic acid (CHEBI:27394) |
| Incoming Relation(s) |
| D-erythro-3-methylmalic acid (CHEBI:27394) is conjugate acid of D-erythro-3-methylmalate(2−) (CHEBI:58511) |
| IUPAC Name |
|---|
| (2R,3S)-2-hydroxy-3-methylbutanedioate |
| UniProt Name | Source |
|---|---|
| (2R,3S)-3-methylmalate | UniProt |