EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O5S |
| Net Charge | 0 |
| Average Mass | 272.282 |
| Monoisotopic Mass | 272.04669 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)[O-])N1C(=O)[C@H]2[NH3+] |
| InChI | InChI=1S/C10H12N2O5S/c1-4(13)17-2-5-3-18-9-6(11)8(14)12(9)7(5)10(15)16/h6,9H,2-3,11H2,1H3,(H,15,16)/t6-,9-/m1/s1 |
| InChIKey | HSHGZXNAXBPPDL-HZGVNTEJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-aminocephalosporanic acid zwitterion (CHEBI:58501) is a amino-acid zwitterion (CHEBI:35238) |
| 7β-aminocephalosporanic acid zwitterion (CHEBI:58501) is tautomer of 7β-aminocephalosporanic acid (CHEBI:2255) |
| Incoming Relation(s) |
| 7β-aminocephalosporanic acid (CHEBI:2255) is tautomer of 7β-aminocephalosporanic acid zwitterion (CHEBI:58501) |
| IUPAC Name |
|---|
| (6R)-3-(acetoxymethyl)-7-ammonio-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| UniProt Name | Source |
|---|---|
| (7R)-7-aminocephalosporanate | UniProt |