EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O9P2 |
| Net Charge | -2 |
| Average Mass | 276.074 |
| Monoisotopic Mass | 275.98110 |
| SMILES | C[C@@]1(CO)OP(=O)([O-])OP(=O)([O-])OC[C@H]1O |
| InChI | InChI=1S/C5H12O9P2/c1-5(3-6)4(7)2-12-15(8,9)14-16(10,11)13-5/h4,6-7H,2-3H2,1H3,(H,8,9)(H,10,11)/p-2/t4-,5+/m1/s1 |
| InChIKey | SFRQRNJMIIUYDI-UHNVWZDZSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate(2−) (CHEBI:58483) is a organophosphate oxoanion (CHEBI:58945) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate(2−) (CHEBI:58483) is conjugate base of 2-C-methyl-D-erythritol 2,4-cyclic diphosphate (CHEBI:18425) |
| Incoming Relation(s) |
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate (CHEBI:18425) is conjugate acid of 2-C-methyl-D-erythritol 2,4-cyclic diphosphate(2−) (CHEBI:58483) |
| IUPAC Name |
|---|
| (6S,7R)-7-hydroxy-6-(hydroxymethyl)-6-methyl-1,3,5,2,4-trioxadiphosphocane-2,4-diolate 2,4-dioxide |
| Synonym | Source |
|---|---|
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-C-methyl-D-erythritol 2,4-cyclic diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9070121 | Beilstein |