EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N2O6S |
| Net Charge | -1 |
| Average Mass | 321.375 |
| Monoisotopic Mass | 321.11258 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)N[C@@H](CS)C(=O)[O-] |
| InChI | InChI=1S/C12H22N2O6S/c1-12(2,6-15)9(17)10(18)13-4-3-8(16)14-7(5-21)11(19)20/h7,9,15,17,21H,3-6H2,1-2H3,(H,13,18)(H,14,16)(H,19,20)/p-1/t7-,9-/m0/s1 |
| InChIKey | QSYCTARXWYLMOF-CBAPKCEASA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(R)-pantothenoyl]-L-cysteinate (CHEBI:58480) has role human metabolite (CHEBI:77746) |
| N-[(R)-pantothenoyl]-L-cysteinate (CHEBI:58480) is a monocarboxylic acid anion (CHEBI:35757) |
| N-[(R)-pantothenoyl]-L-cysteinate (CHEBI:58480) is conjugate base of N-[(R)-pantothenoyl]-L-cysteine (CHEBI:18416) |
| Incoming Relation(s) |
| N-[(R)-pantothenoyl]-L-cysteine (CHEBI:18416) is conjugate acid of N-[(R)-pantothenoyl]-L-cysteinate (CHEBI:58480) |
| IUPAC Name |
|---|
| N-{N-[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]-β-alanyl}-L-cysteinate |
| UniProt Name | Source |
|---|---|
| N-[(R)-pantothenoyl]-L-cysteine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6584591 | Beilstein |