EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N4O6S |
| Net Charge | 0 |
| Average Mass | 458.496 |
| Monoisotopic Mass | 458.12601 |
| SMILES | Cc1nc(=O)c2cc(CN(C)c3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)s3)ccc2n1 |
| InChI | InChI=1S/C21H22N4O6S/c1-11-22-14-4-3-12(9-13(14)19(28)23-11)10-25(2)17-7-6-16(32-17)20(29)24-15(21(30)31)5-8-18(26)27/h3-4,6-7,9,15H,5,8,10H2,1-2H3,(H,24,29)(H,26,27)(H,30,31)(H,22,23,28)/t15-/m0/s1 |
| InChIKey | IVTVGDXNLFLDRM-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ICI D1694 (CHEBI:5847) has role antineoplastic agent (CHEBI:35610) |
| ICI D1694 (CHEBI:5847) is a N-acyl-amino acid (CHEBI:51569) |
| ICI D1694 (CHEBI:5847) is a glutamic acid derivative (CHEBI:24315) |
| ICI D1694 (CHEBI:5847) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| D-1694 | DrugCentral |
| ICI D1694 | KEGG COMPOUND |
| ICI-D1694 | DrugCentral |
| raltitrexed | ChEMBL |
| Raltitrexed | KEGG COMPOUND |
| Tomudex | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2353 | DrugCentral |
| C11372 | KEGG COMPOUND |
| D01064 | KEGG DRUG |
| D16 | PDBeChem |
| HMDB0014438 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:112887-68-0 | KEGG COMPOUND |
| Citations |
|---|