EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O17P2 |
| Net Charge | -2 |
| Average Mass | 564.286 |
| Monoisotopic Mass | 564.04047 |
| SMILES | [H][C@@]1([C@H](O)CO)OC(OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24N2O17P2/c18-3-5(19)12-9(22)11(24)14(32-12)33-36(28,29)34-35(26,27)30-4-6-8(21)10(23)13(31-6)17-2-1-7(20)16-15(17)25/h1-2,5-6,8-14,18-19,21-24H,3-4H2,(H,26,27)(H,28,29)(H,16,20,25)/p-2/t5-,6-,8-,9-,10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | ZQLQOXLUCGXKHS-MKTQLATLSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-D-galactofuranose(2−) (CHEBI:58423) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| UDP-D-galactofuranose(2−) (CHEBI:58423) is conjugate base of UDP-D-galactofuranose (CHEBI:18251) |
| Incoming Relation(s) |
| UDP-α-D-galactofuranose(2−) (CHEBI:66915) is a UDP-D-galactofuranose(2−) (CHEBI:58423) |
| UDP-D-galactofuranose (CHEBI:18251) is conjugate acid of UDP-D-galactofuranose(2−) (CHEBI:58423) |