EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H71MgN4O5 |
| Net Charge | -1 |
| Average Mass | 892.501 |
| Monoisotopic Mass | 891.52804 |
| SMILES | C=Cc1c(C)c2[n]3c1C=C1C(C)=C(CC)C4=[N+]1[Mg-2]31[n]3c(c(C)c5c3=C(C3=[N+]1C(=C2)[C@@H](C)[C@@H]3CCC(=O)OC/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C-](C(=O)OC)C5=O)=C4 |
| InChI | InChI=1S/C55H72N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,26,28-33,37,41H,1,14-25,27H2,2-12H3,(H-,56,57,58,59,61);/q-2;+2/p-1/b34-26+;/t32-,33-,37+,41+;/m1./s1 |
| InChIKey | VSRAJQZEEBBURZ-ONWAGYJKSA-M |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyll a(1−) (CHEBI:58416) has role cofactor (CHEBI:23357) |
| chlorophyll a(1−) (CHEBI:58416) is a chlorophyll(1−) (CHEBI:139291) |
| chlorophyll a(1−) (CHEBI:58416) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| chlorophyll a(1−) (CHEBI:58416) is conjugate base of chlorophyll a (CHEBI:18230) |
| Incoming Relation(s) |
| 71-hydroxychlorophyll a(1−) (CHEBI:83377) has functional parent chlorophyll a(1−) (CHEBI:58416) |
| chlorophyll a (CHEBI:18230) is conjugate acid of chlorophyll a(1−) (CHEBI:58416) |
| UniProt Name | Source |
|---|---|
| chlorophyll a | UniProt |