EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O15P3 |
| Net Charge | -6 |
| Average Mass | 414.045 |
| Monoisotopic Mass | 413.91872 |
| SMILES | O=P([O-])([O-])O[C@H]1[C@H](O)[C@@H](O)[C@H](OP(=O)([O-])[O-])[C@@H](OP(=O)([O-])[O-])[C@H]1O |
| InChI | InChI=1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/p-6/t1-,2-,3+,4+,5+,6+/m1/s1 |
| InChIKey | MMWCIQZXVOZEGG-MLQGYMEPSA-H |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-myo-inositol 1,3,4-trisphosphate(6−) (CHEBI:58414) has role human metabolite (CHEBI:77746) |
| 1D-myo-inositol 1,3,4-trisphosphate(6−) (CHEBI:58414) is a inositol phosphate oxoanion (CHEBI:76301) |
| 1D-myo-inositol 1,3,4-trisphosphate(6−) (CHEBI:58414) is conjugate base of 1D-myo-inositol 1,3,4-trisphosphate (CHEBI:18228) |
| Incoming Relation(s) |
| 1D-myo-inositol 1,3,4-trisphosphate (CHEBI:18228) is conjugate acid of 1D-myo-inositol 1,3,4-trisphosphate(6−) (CHEBI:58414) |
| IUPAC Name |
|---|
| (1S,2S,3S,4S,5R,6R)-3,5,6-trihydroxycyclohexane-1,2,4-triyl tris(phosphate) |
| UniProt Name | Source |
|---|---|
| 1D-myo-inositol 1,3,4-trisphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4896056 | Beilstein |