EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10NO5 |
| Net Charge | -1 |
| Average Mass | 224.192 |
| Monoisotopic Mass | 224.05645 |
| SMILES | C=C(O[C@@H]1C=C(C(=O)[O-])C=C[C@H]1[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C10H11NO5/c1-5(9(12)13)16-8-4-6(10(14)15)2-3-7(8)11/h2-4,7-8H,1,11H2,(H,12,13)(H,14,15)/p-1/t7-,8-/m1/s1 |
| InChIKey | OIUJHGOLFKDBSU-HTQZYQBOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-amino-4-deoxychorismate(1−) (CHEBI:58406) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 4-amino-4-deoxychorismate(1−) (CHEBI:58406) is conjugate acid of 4-amino-4-deoxychorismate(2−) (CHEBI:35181) |
| 4-amino-4-deoxychorismate(1−) (CHEBI:58406) is conjugate base of 4-amino-4-deoxychorismic acid (CHEBI:18198) |
| Incoming Relation(s) |
| 4-amino-4-deoxychorismic acid (CHEBI:18198) is conjugate acid of 4-amino-4-deoxychorismate(1−) (CHEBI:58406) |
| 4-amino-4-deoxychorismate(2−) (CHEBI:35181) is conjugate base of 4-amino-4-deoxychorismate(1−) (CHEBI:58406) |
| IUPAC Name |
|---|
| (3R,4R)-4-ammonio-3-[(1-carboxylatovinyl)oxy]cyclohexa-1,5-diene-1-carboxylate |
| UniProt Name | Source |
|---|---|
| 4-amino-4-deoxychorismate | UniProt |