EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16668 - hypotaurine
| Formula | C2H7NO2S |
| Net Charge | 0 |
| Average Mass | 109.150 |
| Monoisotopic Mass | 109.01975 |
| SMILES | NCCS(=O)O |
| InChI | InChI=1S/C2H7NO2S/c3-1-2-6(4)5/h1-3H2,(H,4,5) |
| InChIKey | VVIUBCNYACGLLV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypotaurine (CHEBI:16668) has role human metabolite (CHEBI:77746) |
| hypotaurine (CHEBI:16668) has role metabolite (CHEBI:25212) |
| hypotaurine (CHEBI:16668) has role mouse metabolite (CHEBI:75771) |
| hypotaurine (CHEBI:16668) is a aminosulfinic acid (CHEBI:37794) |
| hypotaurine (CHEBI:16668) is conjugate acid of hypotaurine(1−) (CHEBI:140741) |
| hypotaurine (CHEBI:16668) is tautomer of hypotaurine zwitterion (CHEBI:57853) |
| Incoming Relation(s) |
| hypotaurocyamine (CHEBI:16209) has functional parent hypotaurine (CHEBI:16668) |
| hypotaurine(1−) (CHEBI:140741) is conjugate base of hypotaurine (CHEBI:16668) |
| hypotaurine zwitterion (CHEBI:57853) is tautomer of hypotaurine (CHEBI:16668) |
| IUPAC Name |
|---|
| 2-aminoethanesulfinic acid |
| Synonyms | Source |
|---|---|
| 2-Aminoethanesulfinic acid | KEGG COMPOUND |
| Hypotaurine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00519 | KEGG COMPOUND |
| HMDB0000965 | HMDB |
| Hypotaurine | Wikipedia |
| HYPOTAURINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1743127 | Reaxys |
| CAS:300-84-5 | KEGG COMPOUND |
| CAS:300-84-5 | ChemIDplus |
| Citations |
|---|