EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H7NO2S |
| Net Charge | 0 |
| Average Mass | 109.150 |
| Monoisotopic Mass | 109.01975 |
| SMILES | [NH3+]CCS(=O)[O-] |
| InChI | InChI=1S/C2H7NO2S/c3-1-2-6(4)5/h1-3H2,(H,4,5) |
| InChIKey | VVIUBCNYACGLLV-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypotaurine zwitterion (CHEBI:57853) is a zwitterion (CHEBI:27369) |
| hypotaurine zwitterion (CHEBI:57853) is conjugate acid of hypotaurine(1−) (CHEBI:140741) |
| hypotaurine zwitterion (CHEBI:57853) is tautomer of hypotaurine (CHEBI:16668) |
| Incoming Relation(s) |
| hypotaurine(1−) (CHEBI:140741) is conjugate base of hypotaurine zwitterion (CHEBI:57853) |
| hypotaurine (CHEBI:16668) is tautomer of hypotaurine zwitterion (CHEBI:57853) |
| IUPAC Name |
|---|
| 2-azaniumylethanesulfinate |
| Synonyms | Source |
|---|---|
| 2-ammonioethanesulfinate | ChEBI |
| 2-azaniumylethane-1-sulfinate | ChEBI |
| 2-mmonioethane-1-sulfinate | ChEBI |
| UniProt Name | Source |
|---|---|
| hypotaurine | UniProt |