EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35O3 |
| Net Charge | -1 |
| Average Mass | 299.475 |
| Monoisotopic Mass | 299.25917 |
| SMILES | CCCCCCCCCCCCCCCC[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h17,19H,2-16H2,1H3,(H,20,21)/p-1/t17-/m0/s1 |
| InChIKey | KIHBGTRZFAVZRV-KRWDZBQOSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-hydroxyoctadecanoate (CHEBI:58386) is a 2-hydroxyoctadecanoate (CHEBI:76724) |
| (S)-2-hydroxyoctadecanoate (CHEBI:58386) is conjugate base of (S)-2-hydroxyoctadecanoic acid (CHEBI:18129) |
| (S)-2-hydroxyoctadecanoate (CHEBI:58386) is enantiomer of (R)-2-hydroxyoctadecanoate (CHEBI:57562) |
| Incoming Relation(s) |
| (S)-2-hydroxyoctadecanoic acid (CHEBI:18129) is conjugate acid of (S)-2-hydroxyoctadecanoate (CHEBI:58386) |
| (R)-2-hydroxyoctadecanoate (CHEBI:57562) is enantiomer of (S)-2-hydroxyoctadecanoate (CHEBI:58386) |
| IUPAC Name |
|---|
| (2S)-2-hydroxyoctadecanoate |
| Synonyms | Source |
|---|---|
| (S)-2-hydroxyoctadecanoate | ChEBI |
| (S)-2-hydroxyoctadecanoate anion | ChEBI |
| (S)-2-hydroxyoctadecanoic acid anion | ChEBI |
| (S)-2-hydroxystearate | ChEBI |
| (S)-2-hydroxystearate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-2-hydroxyoctadecanoate | UniProt |