EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12NO6S |
| Net Charge | -1 |
| Average Mass | 274.274 |
| Monoisotopic Mass | 274.03908 |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H13NO6S/c1-16-10(12)9(11)6-7-2-4-8(5-3-7)17-18(13,14)15/h2-5,9H,6,11H2,1H3,(H,13,14,15)/p-1/t9-/m0/s1 |
| InChIKey | VBDFIILFQPTRLI-VIFPVBQESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tyrosine methyl ester 4-sulfate(1−) (CHEBI:58377) is a phenyl sulfate oxoanion (CHEBI:140317) |
| L-tyrosine methyl ester 4-sulfate(1−) (CHEBI:58377) is conjugate base of L-tyrosine methyl ester 4-sulfate (CHEBI:18103) |
| Incoming Relation(s) |
| L-tyrosine methyl ester 4-sulfate (CHEBI:18103) is conjugate acid of L-tyrosine methyl ester 4-sulfate(1−) (CHEBI:58377) |
| IUPAC Name |
|---|
| methyl O-sulfonato-L-tyrosinate |
| Synonyms | Source |
|---|---|
| L-tyrosine methyl ester 4-sulfate | ChEBI |
| L-tyrosine methyl ester 4-sulfate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-tyrosine methyl ester 4-sulfate | UniProt |