EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H53O4 |
| Net Charge | -1 |
| Average Mass | 561.827 |
| Monoisotopic Mass | 561.39493 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/Cc1cc(C(=O)[O-])cc(O)c1O |
| InChI | InChI=1S/C37H54O4/c1-27(2)13-8-14-28(3)15-9-16-29(4)17-10-18-30(5)19-11-20-31(6)21-12-22-32(7)23-24-33-25-34(37(40)41)26-35(38)36(33)39/h13,15,17,19,21,23,25-26,38-39H,8-12,14,16,18,20,22,24H2,1-7H3,(H,40,41)/p-1/b28-15+,29-17+,30-19+,31-21+,32-23+ |
| InChIKey | VEPICJBQCOUQPI-IRVXXIIISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hexaprenyl-4,5-dihydroxybenzoate (CHEBI:58373) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-hexaprenyl-4,5-dihydroxybenzoate (CHEBI:58373) is a 3,4-dihydroxy-5-polyprenylbenzoate (CHEBI:64694) |
| 3-hexaprenyl-4,5-dihydroxybenzoate (CHEBI:58373) is conjugate base of 3-hexaprenyl-4,5-dihydroxybenzoic acid (CHEBI:18081) |
| Incoming Relation(s) |
| 3-hexaprenyl-4,5-dihydroxybenzoic acid (CHEBI:18081) is conjugate acid of 3-hexaprenyl-4,5-dihydroxybenzoate (CHEBI:58373) |
| IUPAC Name |
|---|
| 3-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaen-1-yl]-4,5-dihydroxybenzoate |
| Synonyms | Source |
|---|---|
| 3-hexaprenyl-4,5-dihydroxybenzoate anion | ChEBI |
| 3-hexaprenyl-4,5-dihydroxybenzoate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,4-dihydroxy-5-(all-trans-hexaprenyl)benzoate | UniProt |