EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O14P3 |
| Net Charge | -3 |
| Average Mass | 479.144 |
| Monoisotopic Mass | 478.96743 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H17N2O14P3/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(24-8)4-23-28(19,20)26-29(21,22)25-27(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,19,20)(H,21,22)(H,11,14,15)(H2,16,17,18)/p-3/t6-,7+,8+/m0/s1 |
| InChIKey | NHVNXKFIZYSCEB-XLPZGREQSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTTP(3−) (CHEBI:58370) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dTTP(3−) (CHEBI:58370) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| dTTP(3−) (CHEBI:58370) is conjugate acid of dTTP(4−) (CHEBI:37568) |
| dTTP(3−) (CHEBI:58370) is conjugate base of dTTP (CHEBI:18077) |
| Incoming Relation(s) |
| dTTP (CHEBI:18077) is conjugate acid of dTTP(3−) (CHEBI:58370) |
| dTTP(4−) (CHEBI:37568) is conjugate base of dTTP(3−) (CHEBI:58370) |
| IUPAC Name |
|---|
| 5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]thymidine |
| Synonym | Source |
|---|---|
| dTTP trianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4284328 | Beilstein |